dimethyl decanedioate


decanedioic acid dimethyl ester; dimethyl decanedioate; dimethyl sebacate; methyl sebacate; sebacic acid dimethyl ester; sebacic acid methyl ester
Links:📏 NIST, 🕷 ChemSpider, ⚗️ OrgSyn
CAS RN:[106-79-6]
Formula:C12H22O4; 230.30 g/mol
InChiKey:ALOUNLDAKADEEB-UHFFFAOYSA-N
SMILES:COC(=O)CCCCCCCCC(=O)OC
Molecular structure of dimethyl decanedioate
Use:solvent and plasticizer for nitrocelluloses and vinyls
Density:0.988 g/mL
Molar volume:233.1 mL/mol
Refractive index:1.438
Molecular refractive power:61.14 mL/mol
Melting point:27 °C
Boiling point:293 °C

Isomers

bis(2,2-dimethylpropyl) oxalate
Molecular structure of bis(2,2-dimethylpropyl) oxalate
bis(1-hydroxycyclohexyl) peroxide
Molecular structure of bis(1-hydroxycyclohexyl) peroxide
bis(3-methylbutyl) oxalate
Molecular structure of bis(3-methylbutyl) oxalate
bis(2-methylpropyl) butanedioate
Molecular structure of bis(2-methylpropyl) butanedioate
dibutyl butanedioate
Molecular structure of dibutyl butanedioate
dibutyl 2-methylpropanedioate
Molecular structure of dibutyl 2-methylpropanedioate
diethylene glycol butyl ether methacrylate
Molecular structure of diethylene glycol butyl ether methacrylate
diethyl 2-ethyl-2-propan-2-ylpropanedioate
Molecular structure of diethyl 2-ethyl-2-propan-2-ylpropanedioate
diethyl isopentylmalonate
Molecular structure of diethyl isopentylmalonate
diethyl octanedioate
Molecular structure of diethyl octanedioate
diethyl (2-pentyl)malonate
Molecular structure of diethyl (2-pentyl)malonate
diethyl 2-pentylpropanedioate
Molecular structure of diethyl 2-pentylpropanedioate
diethyl 2,2,3,3-tetramethylbutanedioate
Molecular structure of diethyl 2,2,3,3-tetramethylbutanedioate
diisopropyl hexanedioate
Molecular structure of diisopropyl hexanedioate
dimethyl decanedioate
Molecular structure of dimethyl decanedioate
dimethyl 3-ethyl-3-propylpentanedioate
Molecular structure of dimethyl 3-ethyl-3-propylpentanedioate
dipentyl oxalate
Molecular structure of dipentyl oxalate
dipropyl hexanedioate
Molecular structure of dipropyl hexanedioate
dipropyl 2-propylpropanedioate
Molecular structure of dipropyl 2-propylpropanedioate
dodecanedioic acid
Molecular structure of dodecanedioic acid
6-(1-hydroxy-1-methylethyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
Molecular structure of 6-(1-hydroxy-1-methylethyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
(1R)-(-)-menthyl glyoxylate monohydrate
Molecular structure of (1R)-(-)-menthyl glyoxylate monohydrate
nonylpropanedioic acid
Molecular structure of nonylpropanedioic acid
2-pentanoyloxyethyl pentanoate
Molecular structure of 2-pentanoyloxyethyl pentanoate
tetraethylbutanedioic acid
Molecular structure of tetraethylbutanedioic acid
3,3,6,6-tetramethyloctanedioic acid
Molecular structure of 3,3,6,6-tetramethyloctanedioic acid